C16H12N3O7- — CID 7007049
2-[[2-(furan-2-carbonylamino)-3-(4-nitrophenyl)prop-2-enoyl]amino]acetate (PubChem CID 7007049) has the molecular formula C16H12N3O7- and a molecular weight of 358.29 g/mol. Its IUPAC name is 2-[[2-(furan-2-carbonylamino)-3-(4-nitrophenyl)prop-2-enoyl]amino]acetate.
| Compound Name | 2-[[2-(furan-2-carbonylamino)-3-(4-nitrophenyl)prop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 7007049 |
| Molecular Formula | C16H12N3O7- |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-[[2-(furan-2-carbonylamino)-3-(4-nitrophenyl)prop-2-enoyl]amino]acetate |
| SMILES | O=C([O-])CNC(=O)C(=Cc1ccc([N+](=O)[O-])cc1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C16H13N3O7/c20-14(21)9-17-15(22)12(18-16(23)13-2-1-7-26-13)8-10-3-5-11(6-4-10)19(24)25/h1-8H,9H2,(H,17,22)(H,18,23)(H,20,21)/p-1 |
| InChIKey | DNAOREXTJBCPCP-UHFFFAOYSA-M |
| XLogP | -0.18 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|