C27H27N3O7 — CID 2885205
benzyl 2-[[2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoyl]amino]-4-methylpentanoate (PubChem CID 2885205) has the molecular formula C27H27N3O7 and a molecular weight of 505.53 g/mol. Its IUPAC name is benzyl 2-[[2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoyl]amino]-4-methylpentanoate.
| Compound Name | benzyl 2-[[2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 2885205 |
| Molecular Formula | C27H27N3O7 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | benzyl 2-[[2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)CC(NC(=O)C(=Cc1cccc([N+](=O)[O-])c1)NC(=O)c1ccco1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H27N3O7/c1-18(2)14-23(27(33)37-17-19-8-4-3-5-9-19)29-25(31)22(28-26(32)24-12-7-13-36-24)16-20-10-6-11-21(15-20)30(34)35/h3-13,15-16,18,23H,14,17H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | YADKQINMTPWLBG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|