C15H12N2O6 — CID 5415762
methyl (E)-2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 5415762) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is methyl (E)-2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | methyl (E)-2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5415762 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | methyl (E)-2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | COC(=O)/C(=C\c1cccc([N+](=O)[O-])c1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C15H12N2O6/c1-22-15(19)12(16-14(18)13-6-3-7-23-13)9-10-4-2-5-11(8-10)17(20)21/h2-9H,1H3,(H,16,18)/b12-9+ |
| InChIKey | OJIRILWKLTXZOY-FMIVXFBMSA-N |
| XLogP | 2.13 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|