C21H16N2O6 — CID 1291915
benzyl 2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 1291915) has the molecular formula C21H16N2O6 and a molecular weight of 392.37 g/mol. Its IUPAC name is benzyl 2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | benzyl 2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 1291915 |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | benzyl 2-(furan-2-carbonylamino)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(OCc1ccccc1)C(=Cc1cccc([N+](=O)[O-])c1)NC(=O)c1ccco1 |
| InChI | InChI=1S/C21H16N2O6/c24-20(19-10-5-11-28-19)22-18(13-16-8-4-9-17(12-16)23(26)27)21(25)29-14-15-6-2-1-3-7-15/h1-13H,14H2,(H,22,24) |
| InChIKey | GTKHFOHAZVSNOX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|