C37H29N3O6S — CID 19301685
N-[(Z)-3-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19301685) has the molecular formula C37H29N3O6S and a molecular weight of 643.72 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301685 |
| Molecular Formula | C37H29N3O6S |
| Molecular Weight | 643.72 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | N-[(Z)-3-[3-[2-(3-nitrophenyl)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)c2cccc([N+](=O)[O-])c2)c1)/C(=C/c1ccc(OCc2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H29N3O6S/c41-35(29-13-7-15-31(22-29)40(44)45)25-47-33-16-8-14-30(23-33)38-37(43)34(39-36(42)28-11-5-2-6-12-28)21-26-17-19-32(20-18-26)46-24-27-9-3-1-4-10-27/h1-23H,24-25H2,(H,38,43)(H,39,42)/b34-21- |
| InChIKey | KCTNDIHOKQWZPQ-ZXSNDDASSA-N |
| XLogP | 7.56 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.72 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|