C44H34N2O4S — CID 19301693
N-[(Z)-3-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19301693) has the molecular formula C44H34N2O4S and a molecular weight of 686.83 g/mol. Its IUPAC name is N-[(Z)-3-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19301693 |
| Molecular Formula | C44H34N2O4S |
| Molecular Weight | 686.83 g/mol |
| Exact Mass | 686.22 |
| IUPAC Name | N-[(Z)-3-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SCC(=O)c2ccc3c(c2)Cc2ccccc2-3)c1)/C(=C/c1ccc(OCc2ccccc2)cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C44H34N2O4S/c47-42(34-20-23-40-35(26-34)25-33-14-7-8-17-39(33)40)29-51-38-16-9-15-36(27-38)45-44(49)41(46-43(48)32-12-5-2-6-13-32)24-30-18-21-37(22-19-30)50-28-31-10-3-1-4-11-31/h1-24,26-27H,25,28-29H2,(H,45,49)(H,46,48)/b41-24- |
| InChIKey | JUDPRGMFNUMMSV-TZRCHIKKSA-N |
| XLogP | 9.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.83 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|