C39H32N2O5S — CID 22783346
N-[(Z)-1-(2,4-dimethoxyphenyl)-3-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22783346) has the molecular formula C39H32N2O5S and a molecular weight of 640.76 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dimethoxyphenyl)-3-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(2,4-dimethoxyphenyl)-3-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22783346 |
| Molecular Formula | C39H32N2O5S |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | N-[(Z)-1-(2,4-dimethoxyphenyl)-3-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SCC(=O)c3ccc4c(c3)Cc3ccccc3-4)cc2)c(OC)c1 |
| InChI | InChI=1S/C39H32N2O5S/c1-45-31-16-12-28(37(23-31)46-2)22-35(41-38(43)25-8-4-3-5-9-25)39(44)40-30-14-17-32(18-15-30)47-24-36(42)27-13-19-34-29(21-27)20-26-10-6-7-11-33(26)34/h3-19,21-23H,20,24H2,1-2H3,(H,40,44)(H,41,43)/b35-22- |
| InChIKey | VJUGYHTYIBRKSG-QHDYCIAZSA-N |
| XLogP | 7.66 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|