C39H35N3O4S — CID 19314613
N-[(E)-3-[3-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314613) has the molecular formula C39H35N3O4S and a molecular weight of 641.79 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314613 |
| Molecular Formula | C39H35N3O4S |
| Molecular Weight | 641.79 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | N-[(E)-3-[3-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanylanilino]-3-oxo-1-(4-phenylmethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | Cc1cccc(NC(=O)CSc2cccc(NC(=O)/C(=C\c3ccc(OCc4ccccc4)cc3)NC(=O)c3ccccc3)c2)c1C |
| InChI | InChI=1S/C39H35N3O4S/c1-27-11-9-18-35(28(27)2)41-37(43)26-47-34-17-10-16-32(24-34)40-39(45)36(42-38(44)31-14-7-4-8-15-31)23-29-19-21-33(22-20-29)46-25-30-12-5-3-6-13-30/h3-24H,25-26H2,1-2H3,(H,40,45)(H,41,43)(H,42,44)/b36-23+ |
| InChIKey | FHIWYWQOBJAITR-GOJREDGKSA-N |
| XLogP | 8.02 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.79 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|