C22H24ClN3O6 — CID 46497617
ethyl (Z)-2-[(4-butoxybenzoyl)amino]-3-(2-chloro-4-nitroanilino)prop-2-enoate (PubChem CID 46497617) has the molecular formula C22H24ClN3O6 and a molecular weight of 461.90 g/mol. Its IUPAC name is ethyl (Z)-2-[(4-butoxybenzoyl)amino]-3-(2-chloro-4-nitroanilino)prop-2-enoate.
| Compound Name | ethyl (Z)-2-[(4-butoxybenzoyl)amino]-3-(2-chloro-4-nitroanilino)prop-2-enoate |
|---|---|
| PubChem CID | 46497617 |
| Molecular Formula | C22H24ClN3O6 |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | ethyl (Z)-2-[(4-butoxybenzoyl)amino]-3-(2-chloro-4-nitroanilino)prop-2-enoate |
| SMILES | CCCCOc1ccc(C(=O)N/C(=C\Nc2ccc([N+](=O)[O-])cc2Cl)C(=O)OCC)cc1 |
| InChI | InChI=1S/C22H24ClN3O6/c1-3-5-12-32-17-9-6-15(7-10-17)21(27)25-20(22(28)31-4-2)14-24-19-11-8-16(26(29)30)13-18(19)23/h6-11,13-14,24H,3-5,12H2,1-2H3,(H,25,27)/b20-14- |
| InChIKey | URHQDJAMTBSBQL-ZHZULCJRSA-N |
| XLogP | 4.67 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|