C18H18Cl2N2O4 — CID 18848350
4-butoxy-3,5-dichloro-N-(2-methyl-5-nitrophenyl)benzamide (PubChem CID 18848350) has the molecular formula C18H18Cl2N2O4 and a molecular weight of 397.26 g/mol. Its IUPAC name is 4-butoxy-3,5-dichloro-N-(2-methyl-5-nitrophenyl)benzamide.
| Compound Name | 4-butoxy-3,5-dichloro-N-(2-methyl-5-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 18848350 |
| Molecular Formula | C18H18Cl2N2O4 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-butoxy-3,5-dichloro-N-(2-methyl-5-nitrophenyl)benzamide |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Nc2cc([N+](=O)[O-])ccc2C)cc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O4/c1-3-4-7-26-17-14(19)8-12(9-15(17)20)18(23)21-16-10-13(22(24)25)6-5-11(16)2/h5-6,8-10H,3-4,7H2,1-2H3,(H,21,23) |
| InChIKey | HEGVJVUEAWRLRX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|