C19H20Cl2N2O4 — CID 18848461
3,5-dichloro-4-hexoxy-N-(2-nitrophenyl)benzamide (PubChem CID 18848461) has the molecular formula C19H20Cl2N2O4 and a molecular weight of 411.29 g/mol. Its IUPAC name is 3,5-dichloro-4-hexoxy-N-(2-nitrophenyl)benzamide.
| Compound Name | 3,5-dichloro-4-hexoxy-N-(2-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 18848461 |
| Molecular Formula | C19H20Cl2N2O4 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 3,5-dichloro-4-hexoxy-N-(2-nitrophenyl)benzamide |
| SMILES | CCCCCCOc1c(Cl)cc(C(=O)Nc2ccccc2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O4/c1-2-3-4-7-10-27-18-14(20)11-13(12-15(18)21)19(24)22-16-8-5-6-9-17(16)23(25)26/h5-6,8-9,11-12H,2-4,7,10H2,1H3,(H,22,24) |
| InChIKey | CBEYMQOHQNHEKL-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|