C20H23Cl2NO4 — CID 18848417
3,5-dichloro-N-(2,5-dimethoxyphenyl)-4-pentoxybenzamide (PubChem CID 18848417) has the molecular formula C20H23Cl2NO4 and a molecular weight of 412.31 g/mol. Its IUPAC name is 3,5-dichloro-N-(2,5-dimethoxyphenyl)-4-pentoxybenzamide.
| Compound Name | 3,5-dichloro-N-(2,5-dimethoxyphenyl)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 18848417 |
| Molecular Formula | C20H23Cl2NO4 |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 3,5-dichloro-N-(2,5-dimethoxyphenyl)-4-pentoxybenzamide |
| SMILES | CCCCCOc1c(Cl)cc(C(=O)Nc2cc(OC)ccc2OC)cc1Cl |
| InChI | InChI=1S/C20H23Cl2NO4/c1-4-5-6-9-27-19-15(21)10-13(11-16(19)22)20(24)23-17-12-14(25-2)7-8-18(17)26-3/h7-8,10-12H,4-6,9H2,1-3H3,(H,23,24) |
| InChIKey | GGHQUKZICADUDH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|