C20H23Cl2NO3 — CID 18848436
3,5-dichloro-N-[(4-methoxyphenyl)methyl]-4-pentoxybenzamide (PubChem CID 18848436) has the molecular formula C20H23Cl2NO3 and a molecular weight of 396.31 g/mol. Its IUPAC name is 3,5-dichloro-N-[(4-methoxyphenyl)methyl]-4-pentoxybenzamide.
| Compound Name | 3,5-dichloro-N-[(4-methoxyphenyl)methyl]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 18848436 |
| Molecular Formula | C20H23Cl2NO3 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 3,5-dichloro-N-[(4-methoxyphenyl)methyl]-4-pentoxybenzamide |
| SMILES | CCCCCOc1c(Cl)cc(C(=O)NCc2ccc(OC)cc2)cc1Cl |
| InChI | InChI=1S/C20H23Cl2NO3/c1-3-4-5-10-26-19-17(21)11-15(12-18(19)22)20(24)23-13-14-6-8-16(25-2)9-7-14/h6-9,11-12H,3-5,10,13H2,1-2H3,(H,23,24) |
| InChIKey | ZTOFMVCKOQJKCB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|