C19H22ClNO5 — CID 55662530
3-chloro-4,5-dimethoxy-N-[[4-(2-methoxyethoxy)phenyl]methyl]benzamide (PubChem CID 55662530) has the molecular formula C19H22ClNO5 and a molecular weight of 379.84 g/mol. Its IUPAC name is 3-chloro-4,5-dimethoxy-N-[[4-(2-methoxyethoxy)phenyl]methyl]benzamide.
| Compound Name | 3-chloro-4,5-dimethoxy-N-[[4-(2-methoxyethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55662530 |
| Molecular Formula | C19H22ClNO5 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3-chloro-4,5-dimethoxy-N-[[4-(2-methoxyethoxy)phenyl]methyl]benzamide |
| SMILES | COCCOc1ccc(CNC(=O)c2cc(Cl)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H22ClNO5/c1-23-8-9-26-15-6-4-13(5-7-15)12-21-19(22)14-10-16(20)18(25-3)17(11-14)24-2/h4-7,10-11H,8-9,12H2,1-3H3,(H,21,22) |
| InChIKey | WCRGXUPJGVVXPU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|