C18H19Cl2NO3 — CID 55662831
2-(2,4-dichlorophenyl)-N-[[4-(2-methoxyethoxy)phenyl]methyl]acetamide (PubChem CID 55662831) has the molecular formula C18H19Cl2NO3 and a molecular weight of 368.26 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[[4-(2-methoxyethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[[4-(2-methoxyethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55662831 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[[4-(2-methoxyethoxy)phenyl]methyl]acetamide |
| SMILES | COCCOc1ccc(CNC(=O)Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2NO3/c1-23-8-9-24-16-6-2-13(3-7-16)12-21-18(22)10-14-4-5-15(19)11-17(14)20/h2-7,11H,8-10,12H2,1H3,(H,21,22) |
| InChIKey | SYFYLWYXFOOQGK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|