C25H36N2O5 — CID 14796219
N-[[4-[2-(dipropylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxybenzamide (PubChem CID 14796219) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is N-[[4-[2-(dipropylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-[2-(dipropylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 14796219 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | N-[[4-[2-(dipropylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCCN(CCC)CCOc1ccc(CNC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H36N2O5/c1-6-12-27(13-7-2)14-15-32-21-10-8-19(9-11-21)18-26-25(28)20-16-22(29-3)24(31-5)23(17-20)30-4/h8-11,16-17H,6-7,12-15,18H2,1-5H3,(H,26,28) |
| InChIKey | PVTIAJYJVKLRCJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |