C20H21N3O5 — CID 108923065
N-[[4-[(2-cyanoacetyl)amino]phenyl]methyl]-3,4,5-trimethoxybenzamide (PubChem CID 108923065) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is N-[[4-[(2-cyanoacetyl)amino]phenyl]methyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-[(2-cyanoacetyl)amino]phenyl]methyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 108923065 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[[4-[(2-cyanoacetyl)amino]phenyl]methyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(NC(=O)CC#N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N3O5/c1-26-16-10-14(11-17(27-2)19(16)28-3)20(25)22-12-13-4-6-15(7-5-13)23-18(24)8-9-21/h4-7,10-11H,8,12H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | VPISRTLIIYOPQD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |