C20H21N3O4 — CID 108923257
2-cyano-N-[4-[[[2-(4-ethoxyphenoxy)acetyl]amino]methyl]phenyl]acetamide (PubChem CID 108923257) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-cyano-N-[4-[[[2-(4-ethoxyphenoxy)acetyl]amino]methyl]phenyl]acetamide.
| Compound Name | 2-cyano-N-[4-[[[2-(4-ethoxyphenoxy)acetyl]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 108923257 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-cyano-N-[4-[[[2-(4-ethoxyphenoxy)acetyl]amino]methyl]phenyl]acetamide |
| SMILES | CCOc1ccc(OCC(=O)NCc2ccc(NC(=O)CC#N)cc2)cc1 |
| InChI | InChI=1S/C20H21N3O4/c1-2-26-17-7-9-18(10-8-17)27-14-20(25)22-13-15-3-5-16(6-4-15)23-19(24)11-12-21/h3-10H,2,11,13-14H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | BXDMGRWVNBGUJB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |