C22H27NO6 — CID 46469688
3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]benzamide (PubChem CID 46469688) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 46469688 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2ccc(OCC3CCCO3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27NO6/c1-25-19-11-16(12-20(26-2)21(19)27-3)22(24)23-13-15-6-8-17(9-7-15)29-14-18-5-4-10-28-18/h6-9,11-12,18H,4-5,10,13-14H2,1-3H3,(H,23,24) |
| InChIKey | GLCHKYZGTOAPOJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |