C17H18ClNO3S — CID 46481831
5-chloro-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide (PubChem CID 46481831) has the molecular formula C17H18ClNO3S and a molecular weight of 351.86 g/mol. Its IUPAC name is 5-chloro-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-chloro-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46481831 |
| Molecular Formula | C17H18ClNO3S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 5-chloro-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccc(OCC2CCCO2)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H18ClNO3S/c18-16-8-7-15(23-16)17(20)19-10-12-3-5-13(6-4-12)22-11-14-2-1-9-21-14/h3-8,14H,1-2,9-11H2,(H,19,20) |
| InChIKey | PNBBFTFYLFJRKS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |