C25H30N2O4 — CID 41412055
4-[[(2R)-oxolan-2-yl]methoxy]-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]benzamide (PubChem CID 41412055) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-[[(2R)-oxolan-2-yl]methoxy]-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]benzamide.
| Compound Name | 4-[[(2R)-oxolan-2-yl]methoxy]-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 41412055 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 4-[[(2R)-oxolan-2-yl]methoxy]-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(C(=O)N2CCCCC2)cc1)c1ccc(OC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C25H30N2O4/c28-24(20-10-12-22(13-11-20)31-18-23-5-4-16-30-23)26-17-19-6-8-21(9-7-19)25(29)27-14-2-1-3-15-27/h6-13,23H,1-5,14-18H2,(H,26,28)/t23-/m1/s1 |
| InChIKey | OYOQYRRZNMJLIW-HSZRJFAPSA-N |
| XLogP | 3.80 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |