C24H36N2O3 — CID 7824799
4-[[(2R)-oxolan-2-yl]methoxy]-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide (PubChem CID 7824799) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is 4-[[(2R)-oxolan-2-yl]methoxy]-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide.
| Compound Name | 4-[[(2R)-oxolan-2-yl]methoxy]-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 7824799 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | 4-[[(2R)-oxolan-2-yl]methoxy]-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide |
| SMILES | O=C(NCC1(N2CCCCC2)CCCCC1)c1ccc(OC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C24H36N2O3/c27-23(20-9-11-21(12-10-20)29-18-22-8-7-17-28-22)25-19-24(13-3-1-4-14-24)26-15-5-2-6-16-26/h9-12,22H,1-8,13-19H2,(H,25,27)/t22-/m1/s1 |
| InChIKey | SBGIKBLYMCDFFM-JOCHJYFZSA-N |
| XLogP | 4.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |