C22H33N3O2 — CID 91792119
4-morpholin-4-yl-N-[(1-pyrrolidin-1-ylcyclohexyl)methyl]benzamide (PubChem CID 91792119) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 4-morpholin-4-yl-N-[(1-pyrrolidin-1-ylcyclohexyl)methyl]benzamide.
| Compound Name | 4-morpholin-4-yl-N-[(1-pyrrolidin-1-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 91792119 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 4-morpholin-4-yl-N-[(1-pyrrolidin-1-ylcyclohexyl)methyl]benzamide |
| SMILES | O=C(NCC1(N2CCCC2)CCCCC1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H33N3O2/c26-21(19-6-8-20(9-7-19)24-14-16-27-17-15-24)23-18-22(10-2-1-3-11-22)25-12-4-5-13-25/h6-9H,1-5,10-18H2,(H,23,26) |
| InChIKey | XHSIMEYJNZTVHC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |