C19H26N2O4 — CID 120544308
1-[[(4-morpholin-4-ylbenzoyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120544308) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[[(4-morpholin-4-ylbenzoyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(4-morpholin-4-ylbenzoyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120544308 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-[[(4-morpholin-4-ylbenzoyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCCCC1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H26N2O4/c22-17(20-14-19(18(23)24)8-2-1-3-9-19)15-4-6-16(7-5-15)21-10-12-25-13-11-21/h4-7H,1-3,8-14H2,(H,20,22)(H,23,24) |
| InChIKey | AELJJZPKIKMPPN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |