C19H26F2N2O4S — CID 8502045
4-(difluoromethylsulfonyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide (PubChem CID 8502045) has the molecular formula C19H26F2N2O4S and a molecular weight of 416.49 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 8502045 |
| Molecular Formula | C19H26F2N2O4S |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide |
| SMILES | O=C(NCC1(N2CCOCC2)CCCCC1)c1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C19H26F2N2O4S/c20-18(21)28(25,26)16-6-4-15(5-7-16)17(24)22-14-19(8-2-1-3-9-19)23-10-12-27-13-11-23/h4-7,18H,1-3,8-14H2,(H,22,24) |
| InChIKey | LGSVQYCQFZAERH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |