C18H26F2N2O3S — CID 16572718
4-(difluoromethylsulfonyl)-N-[[1-(dimethylamino)cycloheptyl]methyl]benzamide (PubChem CID 16572718) has the molecular formula C18H26F2N2O3S and a molecular weight of 388.48 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-[[1-(dimethylamino)cycloheptyl]methyl]benzamide.
| Compound Name | 4-(difluoromethylsulfonyl)-N-[[1-(dimethylamino)cycloheptyl]methyl]benzamide |
|---|---|
| PubChem CID | 16572718 |
| Molecular Formula | C18H26F2N2O3S |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-[[1-(dimethylamino)cycloheptyl]methyl]benzamide |
| SMILES | CN(C)C1(CNC(=O)c2ccc(S(=O)(=O)C(F)F)cc2)CCCCCC1 |
| InChI | InChI=1S/C18H26F2N2O3S/c1-22(2)18(11-5-3-4-6-12-18)13-21-16(23)14-7-9-15(10-8-14)26(24,25)17(19)20/h7-10,17H,3-6,11-13H2,1-2H3,(H,21,23) |
| InChIKey | NHGWXPZWUYCRIK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |