C16H24ClFN2O — CID 21409921
N-[[1-(dimethylamino)cyclohexyl]methyl]-4-fluorobenzamide;hydrochloride (PubChem CID 21409921) has the molecular formula C16H24ClFN2O and a molecular weight of 314.83 g/mol. Its IUPAC name is N-[[1-(dimethylamino)cyclohexyl]methyl]-4-fluorobenzamide;hydrochloride.
| Compound Name | N-[[1-(dimethylamino)cyclohexyl]methyl]-4-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 21409921 |
| Molecular Formula | C16H24ClFN2O |
| Molecular Weight | 314.83 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[[1-(dimethylamino)cyclohexyl]methyl]-4-fluorobenzamide;hydrochloride |
| SMILES | CN(C)C1(CNC(=O)c2ccc(F)cc2)CCCCC1.Cl |
| InChI | InChI=1S/C16H23FN2O.ClH/c1-19(2)16(10-4-3-5-11-16)12-18-15(20)13-6-8-14(17)9-7-13;/h6-9H,3-5,10-12H2,1-2H3,(H,18,20);1H |
| InChIKey | VAQIHMCFBXXPJA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.83 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |