C19H26F2N2O2S — CID 18148355
4-(difluoromethylsulfanyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide (PubChem CID 18148355) has the molecular formula C19H26F2N2O2S and a molecular weight of 384.49 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 18148355 |
| Molecular Formula | C19H26F2N2O2S |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]benzamide |
| SMILES | O=C(NCC1(N2CCOCC2)CCCCC1)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C19H26F2N2O2S/c20-18(21)26-16-6-4-15(5-7-16)17(24)22-14-19(8-2-1-3-9-19)23-10-12-25-13-11-23/h4-7,18H,1-3,8-14H2,(H,22,24) |
| InChIKey | DCEIWGSYMUYXQO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |