C23H27NO3 — CID 55492878
4-(oxolan-2-ylmethoxy)-N-[(1-phenylcyclobutyl)methyl]benzamide (PubChem CID 55492878) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 4-(oxolan-2-ylmethoxy)-N-[(1-phenylcyclobutyl)methyl]benzamide.
| Compound Name | 4-(oxolan-2-ylmethoxy)-N-[(1-phenylcyclobutyl)methyl]benzamide |
|---|---|
| PubChem CID | 55492878 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-(oxolan-2-ylmethoxy)-N-[(1-phenylcyclobutyl)methyl]benzamide |
| SMILES | O=C(NCC1(c2ccccc2)CCC1)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C23H27NO3/c25-22(24-17-23(13-5-14-23)19-6-2-1-3-7-19)18-9-11-20(12-10-18)27-16-21-8-4-15-26-21/h1-3,6-7,9-12,21H,4-5,8,13-17H2,(H,24,25) |
| InChIKey | YCBAPDGJBAENEB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |