C22H25N3O5 — CID 46494621
N-(2-amino-2-oxoethyl)-4-[[[4-(oxolan-2-ylmethoxy)benzoyl]amino]methyl]benzamide (PubChem CID 46494621) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-4-[[[4-(oxolan-2-ylmethoxy)benzoyl]amino]methyl]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-4-[[[4-(oxolan-2-ylmethoxy)benzoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 46494621 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-4-[[[4-(oxolan-2-ylmethoxy)benzoyl]amino]methyl]benzamide |
| SMILES | NC(=O)CNC(=O)c1ccc(CNC(=O)c2ccc(OCC3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C22H25N3O5/c23-20(26)13-25-22(28)16-5-3-15(4-6-16)12-24-21(27)17-7-9-18(10-8-17)30-14-19-2-1-11-29-19/h3-10,19H,1-2,11-14H2,(H2,23,26)(H,24,27)(H,25,28) |
| InChIKey | HTAXUQHAARDZJE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |