C22H26ClNO3 — CID 46470652
3-(3-chloro-4-methylphenyl)-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]propanamide (PubChem CID 46470652) has the molecular formula C22H26ClNO3 and a molecular weight of 387.91 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 46470652 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]propanamide |
| SMILES | Cc1ccc(CCC(=O)NCc2ccc(OCC3CCCO3)cc2)cc1Cl |
| InChI | InChI=1S/C22H26ClNO3/c1-16-4-5-17(13-21(16)23)8-11-22(25)24-14-18-6-9-19(10-7-18)27-15-20-3-2-12-26-20/h4-7,9-10,13,20H,2-3,8,11-12,14-15H2,1H3,(H,24,25) |
| InChIKey | BXQUZYWNLLPIFM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |