C12H16ClNO5 — CID 79676765
3-chloro-4,5-dimethoxy-N-(2-methoxyethoxy)benzamide (PubChem CID 79676765) has the molecular formula C12H16ClNO5 and a molecular weight of 289.72 g/mol. Its IUPAC name is 3-chloro-4,5-dimethoxy-N-(2-methoxyethoxy)benzamide.
| Compound Name | 3-chloro-4,5-dimethoxy-N-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 79676765 |
| Molecular Formula | C12H16ClNO5 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3-chloro-4,5-dimethoxy-N-(2-methoxyethoxy)benzamide |
| SMILES | COCCONC(=O)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C12H16ClNO5/c1-16-4-5-19-14-12(15)8-6-9(13)11(18-3)10(7-8)17-2/h6-7H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | MRASPKOJSFKELY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|