C12H14ClNO6 — CID 80748225
(2R)-2-[(3-chloro-4,5-dimethoxybenzoyl)amino]-3-hydroxypropanoic acid (PubChem CID 80748225) has the molecular formula C12H14ClNO6 and a molecular weight of 303.70 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-4,5-dimethoxybenzoyl)amino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(3-chloro-4,5-dimethoxybenzoyl)amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80748225 |
| Molecular Formula | C12H14ClNO6 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (2R)-2-[(3-chloro-4,5-dimethoxybenzoyl)amino]-3-hydroxypropanoic acid |
| SMILES | COc1cc(C(=O)N[C@H](CO)C(=O)O)cc(Cl)c1OC |
| InChI | InChI=1S/C12H14ClNO6/c1-19-9-4-6(3-7(13)10(9)20-2)11(16)14-8(5-15)12(17)18/h3-4,8,15H,5H2,1-2H3,(H,14,16)(H,17,18)/t8-/m1/s1 |
| InChIKey | AREZLZYQARVUNT-MRVPVSSYSA-N |
| XLogP | 0.53 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |