C13H15Cl2NO4 — CID 43631004
2-[(3,5-dichloro-4-methoxybenzoyl)amino]pentanoic acid (PubChem CID 43631004) has the molecular formula C13H15Cl2NO4 and a molecular weight of 320.17 g/mol. Its IUPAC name is 2-[(3,5-dichloro-4-methoxybenzoyl)amino]pentanoic acid.
| Compound Name | 2-[(3,5-dichloro-4-methoxybenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 43631004 |
| Molecular Formula | C13H15Cl2NO4 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 2-[(3,5-dichloro-4-methoxybenzoyl)amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1cc(Cl)c(OC)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C13H15Cl2NO4/c1-3-4-10(13(18)19)16-12(17)7-5-8(14)11(20-2)9(15)6-7/h5-6,10H,3-4H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | ZIWHAHLAMQBQGM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |