C11H13Cl2NO4 — CID 65315023
3,5-dichloro-N-(1,3-dihydroxypropan-2-yl)-4-methoxybenzamide (PubChem CID 65315023) has the molecular formula C11H13Cl2NO4 and a molecular weight of 294.13 g/mol. Its IUPAC name is 3,5-dichloro-N-(1,3-dihydroxypropan-2-yl)-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-(1,3-dihydroxypropan-2-yl)-4-methoxybenzamide |
|---|---|
| PubChem CID | 65315023 |
| Molecular Formula | C11H13Cl2NO4 |
| Molecular Weight | 294.13 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | 3,5-dichloro-N-(1,3-dihydroxypropan-2-yl)-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)NC(CO)CO)cc1Cl |
| InChI | InChI=1S/C11H13Cl2NO4/c1-18-10-8(12)2-6(3-9(10)13)11(17)14-7(4-15)5-16/h2-3,7,15-16H,4-5H2,1H3,(H,14,17) |
| InChIKey | XAXFATARLQQORZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.13 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |