C12H16ClNO4 — CID 43419055
3-chloro-N-(1-hydroxypropan-2-yl)-4,5-dimethoxybenzamide (PubChem CID 43419055) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-chloro-N-(1-hydroxypropan-2-yl)-4,5-dimethoxybenzamide.
| Compound Name | 3-chloro-N-(1-hydroxypropan-2-yl)-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 43419055 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-chloro-N-(1-hydroxypropan-2-yl)-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(C)CO)cc(Cl)c1OC |
| InChI | InChI=1S/C12H16ClNO4/c1-7(6-15)14-12(16)8-4-9(13)11(18-3)10(5-8)17-2/h4-5,7,15H,6H2,1-3H3,(H,14,16) |
| InChIKey | ZGYSLPMACQMSIQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |