C13H18ClNO4 — CID 93041589
3-chloro-N-[(2R)-1-hydroxybutan-2-yl]-4,5-dimethoxybenzamide (PubChem CID 93041589) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-1-hydroxybutan-2-yl]-4,5-dimethoxybenzamide.
| Compound Name | 3-chloro-N-[(2R)-1-hydroxybutan-2-yl]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 93041589 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-chloro-N-[(2R)-1-hydroxybutan-2-yl]-4,5-dimethoxybenzamide |
| SMILES | CC[C@H](CO)NC(=O)c1cc(Cl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H18ClNO4/c1-4-9(7-16)15-13(17)8-5-10(14)12(19-3)11(6-8)18-2/h5-6,9,16H,4,7H2,1-3H3,(H,15,17)/t9-/m1/s1 |
| InChIKey | GTMOIOLSOZBIRN-SECBINFHSA-N |
| XLogP | 1.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |