C15H21NO8S — CID 21402561
4-methylsulfonyl-2-[(3,4,5-trimethoxybenzoyl)amino]butanoic acid (PubChem CID 21402561) has the molecular formula C15H21NO8S and a molecular weight of 375.40 g/mol. Its IUPAC name is 4-methylsulfonyl-2-[(3,4,5-trimethoxybenzoyl)amino]butanoic acid.
| Compound Name | 4-methylsulfonyl-2-[(3,4,5-trimethoxybenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 21402561 |
| Molecular Formula | C15H21NO8S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 4-methylsulfonyl-2-[(3,4,5-trimethoxybenzoyl)amino]butanoic acid |
| SMILES | COc1cc(C(=O)NC(CCS(C)(=O)=O)C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C15H21NO8S/c1-22-11-7-9(8-12(23-2)13(11)24-3)14(17)16-10(15(18)19)5-6-25(4,20)21/h7-8,10H,5-6H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | JFJBPKZGCUZRDC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |