C23H27NO8S — CID 21402536
5-(4-methoxybenzoyl)sulfanyl-2-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid (PubChem CID 21402536) has the molecular formula C23H27NO8S and a molecular weight of 477.54 g/mol. Its IUPAC name is 5-(4-methoxybenzoyl)sulfanyl-2-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid.
| Compound Name | 5-(4-methoxybenzoyl)sulfanyl-2-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 21402536 |
| Molecular Formula | C23H27NO8S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 5-(4-methoxybenzoyl)sulfanyl-2-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid |
| SMILES | COc1ccc(C(=O)SCCCC(NC(=O)c2cc(OC)c(OC)c(OC)c2)C(=O)O)cc1 |
| InChI | InChI=1S/C23H27NO8S/c1-29-16-9-7-14(8-10-16)23(28)33-11-5-6-17(22(26)27)24-21(25)15-12-18(30-2)20(32-4)19(13-15)31-3/h7-10,12-13,17H,5-6,11H2,1-4H3,(H,24,25)(H,26,27) |
| InChIKey | GBIWDRZNVBDKFB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|