C16H20ClNO5 — CID 120693130
(E)-2-[(3-chloro-4-ethoxy-5-methoxybenzoyl)amino]hex-4-enoic acid (PubChem CID 120693130) has the molecular formula C16H20ClNO5 and a molecular weight of 341.79 g/mol. Its IUPAC name is (E)-2-[(3-chloro-4-ethoxy-5-methoxybenzoyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(3-chloro-4-ethoxy-5-methoxybenzoyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693130 |
| Molecular Formula | C16H20ClNO5 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (E)-2-[(3-chloro-4-ethoxy-5-methoxybenzoyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cc(Cl)c(OCC)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C16H20ClNO5/c1-4-6-7-12(16(20)21)18-15(19)10-8-11(17)14(23-5-2)13(9-10)22-3/h4,6,8-9,12H,5,7H2,1-3H3,(H,18,19)(H,20,21)/b6-4+ |
| InChIKey | YKPOTBWNEXKFKI-GQCTYLIASA-N |
| XLogP | 2.90 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|