C14H16FNO4 — CID 120694126
(E)-2-[(3-fluoro-4-methoxybenzoyl)amino]hex-4-enoic acid (PubChem CID 120694126) has the molecular formula C14H16FNO4 and a molecular weight of 281.28 g/mol. Its IUPAC name is (E)-2-[(3-fluoro-4-methoxybenzoyl)amino]hex-4-enoic acid.
| Compound Name | (E)-2-[(3-fluoro-4-methoxybenzoyl)amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694126 |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (E)-2-[(3-fluoro-4-methoxybenzoyl)amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1ccc(OC)c(F)c1)C(=O)O |
| InChI | InChI=1S/C14H16FNO4/c1-3-4-5-11(14(18)19)16-13(17)9-6-7-12(20-2)10(15)8-9/h3-4,6-8,11H,5H2,1-2H3,(H,16,17)(H,18,19)/b4-3+ |
| InChIKey | XGXOZUKVMZNEHQ-ONEGZZNKSA-N |
| XLogP | 1.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|