C16H22N2O6S — CID 120693885
(E)-2-[[3-(dimethylsulfamoyl)-4-methoxybenzoyl]amino]hex-4-enoic acid (PubChem CID 120693885) has the molecular formula C16H22N2O6S and a molecular weight of 370.43 g/mol. Its IUPAC name is (E)-2-[[3-(dimethylsulfamoyl)-4-methoxybenzoyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[3-(dimethylsulfamoyl)-4-methoxybenzoyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693885 |
| Molecular Formula | C16H22N2O6S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (E)-2-[[3-(dimethylsulfamoyl)-4-methoxybenzoyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1ccc(OC)c(S(=O)(=O)N(C)C)c1)C(=O)O |
| InChI | InChI=1S/C16H22N2O6S/c1-5-6-7-12(16(20)21)17-15(19)11-8-9-13(24-4)14(10-11)25(22,23)18(2)3/h5-6,8-10,12H,7H2,1-4H3,(H,17,19)(H,20,21)/b6-5+ |
| InChIKey | PYOJUFKVRQOTPA-AATRIKPKSA-N |
| XLogP | 1.09 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|