C15H25N3O4S — CID 120650659
3-(dimethylsulfamoyl)-N-[(2R)-2-(ethylamino)propyl]-4-methoxybenzamide (PubChem CID 120650659) has the molecular formula C15H25N3O4S and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[(2R)-2-(ethylamino)propyl]-4-methoxybenzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[(2R)-2-(ethylamino)propyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 120650659 |
| Molecular Formula | C15H25N3O4S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[(2R)-2-(ethylamino)propyl]-4-methoxybenzamide |
| SMILES | CCN[C@H](C)CNC(=O)c1ccc(OC)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C15H25N3O4S/c1-6-16-11(2)10-17-15(19)12-7-8-13(22-5)14(9-12)23(20,21)18(3)4/h7-9,11,16H,6,10H2,1-5H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | SHIPUOGEERRMKZ-LLVKDONJSA-N |
| XLogP | 0.67 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |