C18H29N3O4 — CID 120654487
N-[(2R)-2-(ethylamino)propyl]-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide (PubChem CID 120654487) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[(2R)-2-(ethylamino)propyl]-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide.
| Compound Name | N-[(2R)-2-(ethylamino)propyl]-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 120654487 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-[(2R)-2-(ethylamino)propyl]-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide |
| SMILES | CCN[C@H](C)CNC(=O)c1ccc(OCC(=O)NC(C)C)c(OC)c1 |
| InChI | InChI=1S/C18H29N3O4/c1-6-19-13(4)10-20-18(23)14-7-8-15(16(9-14)24-5)25-11-17(22)21-12(2)3/h7-9,12-13,19H,6,10-11H2,1-5H3,(H,20,23)(H,21,22)/t13-/m1/s1 |
| InChIKey | NZTNGAUCBPOYFH-CYBMUJFWSA-N |
| XLogP | 1.33 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |