C16H24N2O4 — CID 167446651
ethene;3-methoxy-N-methyl-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide (PubChem CID 167446651) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is ethene;3-methoxy-N-methyl-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide.
| Compound Name | ethene;3-methoxy-N-methyl-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 167446651 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | ethene;3-methoxy-N-methyl-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide |
| SMILES | C=C.CNC(=O)c1ccc(OCC(=O)NC(C)C)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O4.C2H4/c1-9(2)16-13(17)8-20-11-6-5-10(14(18)15-3)7-12(11)19-4;1-2/h5-7,9H,8H2,1-4H3,(H,15,18)(H,16,17);1-2H2 |
| InChIKey | YPPJRNPLMIJTSS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|