C24H32N2O6 — CID 55777600
N-(2-butoxy-5-methoxyphenyl)-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide (PubChem CID 55777600) has the molecular formula C24H32N2O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is N-(2-butoxy-5-methoxyphenyl)-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide.
| Compound Name | N-(2-butoxy-5-methoxyphenyl)-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 55777600 |
| Molecular Formula | C24H32N2O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | N-(2-butoxy-5-methoxyphenyl)-3-methoxy-4-[2-oxo-2-(propan-2-ylamino)ethoxy]benzamide |
| SMILES | CCCCOc1ccc(OC)cc1NC(=O)c1ccc(OCC(=O)NC(C)C)c(OC)c1 |
| InChI | InChI=1S/C24H32N2O6/c1-6-7-12-31-20-11-9-18(29-4)14-19(20)26-24(28)17-8-10-21(22(13-17)30-5)32-15-23(27)25-16(2)3/h8-11,13-14,16H,6-7,12,15H2,1-5H3,(H,25,27)(H,26,28) |
| InChIKey | YUHCEHVOYVJZBI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|