C19H25ClN2O4 — CID 119421240
N-(2-amino-5-methoxyphenyl)-4-butoxy-3-methoxybenzamide;hydrochloride (PubChem CID 119421240) has the molecular formula C19H25ClN2O4 and a molecular weight of 380.87 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)-4-butoxy-3-methoxybenzamide;hydrochloride.
| Compound Name | N-(2-amino-5-methoxyphenyl)-4-butoxy-3-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119421240 |
| Molecular Formula | C19H25ClN2O4 |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)-4-butoxy-3-methoxybenzamide;hydrochloride |
| SMILES | CCCCOc1ccc(C(=O)Nc2cc(OC)ccc2N)cc1OC.Cl |
| InChI | InChI=1S/C19H24N2O4.ClH/c1-4-5-10-25-17-9-6-13(11-18(17)24-3)19(22)21-16-12-14(23-2)7-8-15(16)20;/h6-9,11-12H,4-5,10,20H2,1-3H3,(H,21,22);1H |
| InChIKey | SYURVDVJGHNWCG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|