C18H19Cl2NO3 — CID 26115429
4-butoxy-N-(2,4-dichlorophenyl)-3-methoxybenzamide (PubChem CID 26115429) has the molecular formula C18H19Cl2NO3 and a molecular weight of 368.26 g/mol. Its IUPAC name is 4-butoxy-N-(2,4-dichlorophenyl)-3-methoxybenzamide.
| Compound Name | 4-butoxy-N-(2,4-dichlorophenyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 26115429 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 4-butoxy-N-(2,4-dichlorophenyl)-3-methoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccc(Cl)cc2Cl)cc1OC |
| InChI | InChI=1S/C18H19Cl2NO3/c1-3-4-9-24-16-8-5-12(10-17(16)23-2)18(22)21-15-7-6-13(19)11-14(15)20/h5-8,10-11H,3-4,9H2,1-2H3,(H,21,22) |
| InChIKey | HUVXDEZFCOHKSH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|