C19H20BrCl2NO2 — CID 4959418
3-bromo-N-(2,4-dichlorophenyl)-4-hexoxybenzamide (PubChem CID 4959418) has the molecular formula C19H20BrCl2NO2 and a molecular weight of 445.18 g/mol. Its IUPAC name is 3-bromo-N-(2,4-dichlorophenyl)-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-(2,4-dichlorophenyl)-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4959418 |
| Molecular Formula | C19H20BrCl2NO2 |
| Molecular Weight | 445.18 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | 3-bromo-N-(2,4-dichlorophenyl)-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C19H20BrCl2NO2/c1-2-3-4-5-10-25-18-9-6-13(11-15(18)20)19(24)23-17-8-7-14(21)12-16(17)22/h6-9,11-12H,2-5,10H2,1H3,(H,23,24) |
| InChIKey | IBTCRQVPXBILBT-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.18 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|