C21H24BrClN2O4 — CID 4959603
3-bromo-N'-[2-(4-chlorophenoxy)acetyl]-4-hexoxybenzohydrazide (PubChem CID 4959603) has the molecular formula C21H24BrClN2O4 and a molecular weight of 483.79 g/mol. Its IUPAC name is 3-bromo-N'-[2-(4-chlorophenoxy)acetyl]-4-hexoxybenzohydrazide.
| Compound Name | 3-bromo-N'-[2-(4-chlorophenoxy)acetyl]-4-hexoxybenzohydrazide |
|---|---|
| PubChem CID | 4959603 |
| Molecular Formula | C21H24BrClN2O4 |
| Molecular Weight | 483.79 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 3-bromo-N'-[2-(4-chlorophenoxy)acetyl]-4-hexoxybenzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)COc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C21H24BrClN2O4/c1-2-3-4-5-12-28-19-11-6-15(13-18(19)22)21(27)25-24-20(26)14-29-17-9-7-16(23)8-10-17/h6-11,13H,2-5,12,14H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | IDXFTGABVTVRGV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.79 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|